C22H26Cl2N2O4S — CID 89204082
4-(3,4-dichlorophenyl)-2-ethyl-1-[[3-(hydroperoxymethyl)-2,3-dihydro-1H-inden-5-yl]sulfonyl]piperazine (PubChem CID 89204082) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-ethyl-1-[[3-(hydroperoxymethyl)-2,3-dihydro-1H-inden-5-yl]sulfonyl]piperazine.
| Compound Name | 4-(3,4-dichlorophenyl)-2-ethyl-1-[[3-(hydroperoxymethyl)-2,3-dihydro-1H-inden-5-yl]sulfonyl]piperazine |
|---|---|
| PubChem CID | 89204082 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-ethyl-1-[[3-(hydroperoxymethyl)-2,3-dihydro-1H-inden-5-yl]sulfonyl]piperazine |
| SMILES | CCC1CN(c2ccc(Cl)c(Cl)c2)CCN1S(=O)(=O)c1ccc2c(c1)C(COO)CC2 |
| InChI | InChI=1S/C22H26Cl2N2O4S/c1-2-17-13-25(18-6-8-21(23)22(24)11-18)9-10-26(17)31(28,29)19-7-5-15-3-4-16(14-30-27)20(15)12-19/h5-8,11-12,16-17,27H,2-4,9-10,13-14H2,1H3 |
| InChIKey | QDNIEVOJDKYKSR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|