C10H16N2O — CID 89204123
N-[(3Z,5Z)-6-amino-4,5-dimethylhexa-1,3,5-trien-2-yl]acetamide (PubChem CID 89204123) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[(3Z,5Z)-6-amino-4,5-dimethylhexa-1,3,5-trien-2-yl]acetamide.
| Compound Name | N-[(3Z,5Z)-6-amino-4,5-dimethylhexa-1,3,5-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 89204123 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[(3Z,5Z)-6-amino-4,5-dimethylhexa-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C(/C=C(C)\C(C)=C/N)NC(C)=O |
| InChI | InChI=1S/C10H16N2O/c1-7(8(2)6-11)5-9(3)12-10(4)13/h5-6H,3,11H2,1-2,4H3,(H,12,13)/b7-5-,8-6- |
| InChIKey | QSLIRPCXYVBQQG-SFECMWDFSA-N |
| XLogP | 1.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|