C15H27NO2 — CID 89204302
2-[(2R)-6,6-dimethyl-2-(2-propan-2-yloxyprop-2-enyl)-2,3-dihydropyran-4-yl]ethanamine (PubChem CID 89204302) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-[(2R)-6,6-dimethyl-2-(2-propan-2-yloxyprop-2-enyl)-2,3-dihydropyran-4-yl]ethanamine.
| Compound Name | 2-[(2R)-6,6-dimethyl-2-(2-propan-2-yloxyprop-2-enyl)-2,3-dihydropyran-4-yl]ethanamine |
|---|---|
| PubChem CID | 89204302 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-[(2R)-6,6-dimethyl-2-(2-propan-2-yloxyprop-2-enyl)-2,3-dihydropyran-4-yl]ethanamine |
| SMILES | C=C(C[C@H]1CC(CCN)=CC(C)(C)O1)OC(C)C |
| InChI | InChI=1S/C15H27NO2/c1-11(2)17-12(3)8-14-9-13(6-7-16)10-15(4,5)18-14/h10-11,14H,3,6-9,16H2,1-2,4-5H3/t14-/m0/s1 |
| InChIKey | TTWWKLDVMUKGOW-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|