C21H40N2 — CID 89204377
N,N'-dibutyl-2-methyl-N'-[(3E)-2-methylidenehexa-3,5-dienyl]pentane-1,5-diamine (PubChem CID 89204377) has the molecular formula C21H40N2 and a molecular weight of 320.57 g/mol. Its IUPAC name is N,N'-dibutyl-2-methyl-N'-[(3E)-2-methylidenehexa-3,5-dienyl]pentane-1,5-diamine.
| Compound Name | N,N'-dibutyl-2-methyl-N'-[(3E)-2-methylidenehexa-3,5-dienyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 89204377 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | N,N'-dibutyl-2-methyl-N'-[(3E)-2-methylidenehexa-3,5-dienyl]pentane-1,5-diamine |
| SMILES | C=C/C=C/C(=C)CN(CCCC)CCCC(C)CNCCCC |
| InChI | InChI=1S/C21H40N2/c1-6-9-13-21(5)19-23(16-11-8-3)17-12-14-20(4)18-22-15-10-7-2/h6,9,13,20,22H,1,5,7-8,10-12,14-19H2,2-4H3/b13-9+ |
| InChIKey | XXDRBIKHEGFAHL-UKTHLTGXSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|