C24H32N5O4P — CID 89204430
5-[methoxy(methyl)phosphoryl]oxy-3-[5-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-dihydro-1H-indol-2-yl]-2H-indazole (PubChem CID 89204430) has the molecular formula C24H32N5O4P and a molecular weight of 485.53 g/mol. Its IUPAC name is 5-[methoxy(methyl)phosphoryl]oxy-3-[5-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-dihydro-1H-indol-2-yl]-2H-indazole.
| Compound Name | 5-[methoxy(methyl)phosphoryl]oxy-3-[5-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-dihydro-1H-indol-2-yl]-2H-indazole |
|---|---|
| PubChem CID | 89204430 |
| Molecular Formula | C24H32N5O4P |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 5-[methoxy(methyl)phosphoryl]oxy-3-[5-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-dihydro-1H-indol-2-yl]-2H-indazole |
| SMILES | COP(C)(=O)Oc1ccc2n[nH]c(C3Cc4cc(OCCN5CCN(C)CC5)ccc4N3)c2c1 |
| InChI | InChI=1S/C24H32N5O4P/c1-28-8-10-29(11-9-28)12-13-32-18-4-6-21-17(14-18)15-23(25-21)24-20-16-19(33-34(3,30)31-2)5-7-22(20)26-27-24/h4-7,14,16,23,25H,8-13,15H2,1-3H3,(H,26,27) |
| InChIKey | DXJSSZHHQBQKLK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|