C21H40F2N2 — CID 89204481
N,N'-dibutyl-N'-[(E)-4,6-difluoro-2-methylidenehex-3-enyl]-2-methylpentane-1,5-diamine (PubChem CID 89204481) has the molecular formula C21H40F2N2 and a molecular weight of 358.56 g/mol. Its IUPAC name is N,N'-dibutyl-N'-[(E)-4,6-difluoro-2-methylidenehex-3-enyl]-2-methylpentane-1,5-diamine.
| Compound Name | N,N'-dibutyl-N'-[(E)-4,6-difluoro-2-methylidenehex-3-enyl]-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 89204481 |
| Molecular Formula | C21H40F2N2 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | N,N'-dibutyl-N'-[(E)-4,6-difluoro-2-methylidenehex-3-enyl]-2-methylpentane-1,5-diamine |
| SMILES | C=C(/C=C(/F)CCF)CN(CCCC)CCCC(C)CNCCCC |
| InChI | InChI=1S/C21H40F2N2/c1-5-7-13-24-17-19(3)10-9-15-25(14-8-6-2)18-20(4)16-21(23)11-12-22/h16,19,24H,4-15,17-18H2,1-3H3/b21-16+ |
| InChIKey | OPPMNQPNUBESEY-LTGZKZEYSA-N |
| XLogP | 5.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|