C29H27ClN4O3 — CID 89204626
benzyl 4-[3-amino-4-(prop-2-enylideneamino)phenyl]-6-[2-(2-chlorophenyl)ethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 89204626) has the molecular formula C29H27ClN4O3 and a molecular weight of 515.01 g/mol. Its IUPAC name is benzyl 4-[3-amino-4-(prop-2-enylideneamino)phenyl]-6-[2-(2-chlorophenyl)ethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl 4-[3-amino-4-(prop-2-enylideneamino)phenyl]-6-[2-(2-chlorophenyl)ethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 89204626 |
| Molecular Formula | C29H27ClN4O3 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | benzyl 4-[3-amino-4-(prop-2-enylideneamino)phenyl]-6-[2-(2-chlorophenyl)ethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=C/C=N/c1ccc(C2NC(=O)NC(CCc3ccccc3Cl)=C2C(=O)OCc2ccccc2)cc1N |
| InChI | InChI=1S/C29H27ClN4O3/c1-2-16-32-24-14-13-21(17-23(24)31)27-26(28(35)37-18-19-8-4-3-5-9-19)25(33-29(36)34-27)15-12-20-10-6-7-11-22(20)30/h2-11,13-14,16-17,27H,1,12,15,18,31H2,(H2,33,34,36)/b32-16+ |
| InChIKey | HQGKWVKNXCDNMU-KPGMTVGESA-N |
| XLogP | 5.79 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|