C25H23F3N4O2 — CID 89204768
N-[1-amino-3-(1H-indol-3-yl)propan-2-yl]-5-(3-aminophenyl)-2-(trifluoromethoxy)benzamide (PubChem CID 89204768) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[1-amino-3-(1H-indol-3-yl)propan-2-yl]-5-(3-aminophenyl)-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-amino-3-(1H-indol-3-yl)propan-2-yl]-5-(3-aminophenyl)-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 89204768 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[1-amino-3-(1H-indol-3-yl)propan-2-yl]-5-(3-aminophenyl)-2-(trifluoromethoxy)benzamide |
| SMILES | NCC(Cc1c[nH]c2ccccc12)NC(=O)c1cc(-c2cccc(N)c2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C25H23F3N4O2/c26-25(27,28)34-23-9-8-16(15-4-3-5-18(30)10-15)12-21(23)24(33)32-19(13-29)11-17-14-31-22-7-2-1-6-20(17)22/h1-10,12,14,19,31H,11,13,29-30H2,(H,32,33) |
| InChIKey | ZDOAHAYNCXKJOO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|