C28H33N7O4 — CID 89204890
prop-2-enyl 2-[8-(3-aminopiperidin-1-yl)-7-ethyl-1-[(3-methylisoquinolin-1-yl)methyl]-2,6-dioxopurin-3-yl]acetate (PubChem CID 89204890) has the molecular formula C28H33N7O4 and a molecular weight of 531.62 g/mol. Its IUPAC name is prop-2-enyl 2-[8-(3-aminopiperidin-1-yl)-7-ethyl-1-[(3-methylisoquinolin-1-yl)methyl]-2,6-dioxopurin-3-yl]acetate.
| Compound Name | prop-2-enyl 2-[8-(3-aminopiperidin-1-yl)-7-ethyl-1-[(3-methylisoquinolin-1-yl)methyl]-2,6-dioxopurin-3-yl]acetate |
|---|---|
| PubChem CID | 89204890 |
| Molecular Formula | C28H33N7O4 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | prop-2-enyl 2-[8-(3-aminopiperidin-1-yl)-7-ethyl-1-[(3-methylisoquinolin-1-yl)methyl]-2,6-dioxopurin-3-yl]acetate |
| SMILES | C=CCOC(=O)Cn1c(=O)n(Cc2nc(C)cc3ccccc23)c(=O)c2c1nc(N1CCCC(N)C1)n2CC |
| InChI | InChI=1S/C28H33N7O4/c1-4-13-39-23(36)17-34-25-24(33(5-2)27(31-25)32-12-8-10-20(29)15-32)26(37)35(28(34)38)16-22-21-11-7-6-9-19(21)14-18(3)30-22/h4,6-7,9,11,14,20H,1,5,8,10,12-13,15-17,29H2,2-3H3 |
| InChIKey | JUPQZNQWVYTZFF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|