C30H24N2O4S2 — CID 89205227
[4-[5-[4-(cyclohexa-1,3-diene-1-carbonyloxy)phenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]cyclohexa-1,3-dien-1-yl] cyclohexa-1,3-diene-1-carboxylate (PubChem CID 89205227) has the molecular formula C30H24N2O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is [4-[5-[4-(cyclohexa-1,3-diene-1-carbonyloxy)phenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]cyclohexa-1,3-dien-1-yl] cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [4-[5-[4-(cyclohexa-1,3-diene-1-carbonyloxy)phenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]cyclohexa-1,3-dien-1-yl] cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 89205227 |
| Molecular Formula | C30H24N2O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | [4-[5-[4-(cyclohexa-1,3-diene-1-carbonyloxy)phenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]cyclohexa-1,3-dien-1-yl] cyclohexa-1,3-diene-1-carboxylate |
| SMILES | O=C(OC1=CC=C(c2nc3sc(-c4ccc(OC(=O)C5=CC=CCC5)cc4)nc3s2)CC1)C1=CC=CCC1 |
| InChI | InChI=1S/C30H24N2O4S2/c33-29(21-7-3-1-4-8-21)35-23-15-11-19(12-16-23)25-31-27-28(37-25)32-26(38-27)20-13-17-24(18-14-20)36-30(34)22-9-5-2-6-10-22/h1-3,5,7,9,11-13,15-17H,4,6,8,10,14,18H2 |
| InChIKey | VGQVQFMSJMSLLD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|