C11H17F2N — CID 89205391
(3E,5Z)-4-(difluoromethyl)-5-ethylocta-3,5,7-trien-3-amine (PubChem CID 89205391) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (3E,5Z)-4-(difluoromethyl)-5-ethylocta-3,5,7-trien-3-amine.
| Compound Name | (3E,5Z)-4-(difluoromethyl)-5-ethylocta-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 89205391 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (3E,5Z)-4-(difluoromethyl)-5-ethylocta-3,5,7-trien-3-amine |
| SMILES | C=C/C=C(CC)\C(=C(/N)CC)C(F)F |
| InChI | InChI=1S/C11H17F2N/c1-4-7-8(5-2)10(11(12)13)9(14)6-3/h4,7,11H,1,5-6,14H2,2-3H3/b8-7-,10-9+ |
| InChIKey | OHUABSDNMOUPIZ-UQGDGPGGSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|