About 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine
1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine (PubChem CID 89205394) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine.
Molecular Properties
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine |
| PubChem CID | 89205394 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine |
| SMILES | C=C/C=C\N/C(N)=N/CCC |
| InChI | InChI=1S/C8H15N3/c1-3-5-7-11-8(9)10-6-4-2/h3,5,7H,1,4,6H2,2H3,(H3,9,10,11)/b7-5- |
| InChIKey | NKSPJFAFQVCRQB-ALCCZGGFSA-N |
| XLogP | 1.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine?
The IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine (CID 89205394) is 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine.
What is the SMILES notation for 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine?
The canonical SMILES for 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine is C=C/C=C\N/C(N)=N/CCC.
What is the InChIKey of 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine?
The InChIKey is NKSPJFAFQVCRQB-ALCCZGGFSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-5-7-11-8(9)10-6-4-2/h3,5,7H,1,4,6H2,2H3,(H3,9,10,11)/b7-5-.
What are the key properties of 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine?
1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine has a molecular weight of 153.23 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-buta-1,3-dienyl]-2-propylguanidine is sourced from PubChem (CID 89205394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).