C11H20N2O2 — CID 89205482
(1E,3E)-1,5-dimethoxy-4-N-propylhexa-1,3,5-triene-1,4-diamine (PubChem CID 89205482) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1E,3E)-1,5-dimethoxy-4-N-propylhexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3E)-1,5-dimethoxy-4-N-propylhexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 89205482 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (1E,3E)-1,5-dimethoxy-4-N-propylhexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C(OC)/C(=C\C=C(/N)OC)NCCC |
| InChI | InChI=1S/C11H20N2O2/c1-5-8-13-10(9(2)14-3)6-7-11(12)15-4/h6-7,13H,2,5,8,12H2,1,3-4H3/b10-6+,11-7+ |
| InChIKey | RZFCVUMWEZYTMA-JMQWPVDRSA-N |
| XLogP | 1.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|