About 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine
2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine (PubChem CID 89205781) has the molecular formula C9H15F2NO
and a molecular weight of 191.22 g/mol. Its IUPAC name is 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine |
| PubChem CID | 89205781 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine |
| SMILES | CCC(F)(F)C(N)C1CC=C(C)O1 |
| InChI | InChI=1S/C9H15F2NO/c1-3-9(10,11)8(12)7-5-4-6(2)13-7/h4,7-8H,3,5,12H2,1-2H3 |
| InChIKey | IRWRYFMRMZVIFI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine?
The IUPAC name of 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine (CID 89205781) is 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine.
What is the SMILES notation for 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine?
The canonical SMILES for 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine is CCC(F)(F)C(N)C1CC=C(C)O1.
What is the InChIKey of 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine?
The InChIKey is IRWRYFMRMZVIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO/c1-3-9(10,11)8(12)7-5-4-6(2)13-7/h4,7-8H,3,5,12H2,1-2H3.
What are the key properties of 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine?
2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine has a molecular weight of 191.22 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1-(5-methyl-2,3-dihydrofuran-2-yl)butan-1-amine is sourced from PubChem (CID 89205781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).