About 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine
2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine (PubChem CID 89205829) has the molecular formula C7H7NO2S
and a molecular weight of 169.21 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine.
Molecular Properties
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine |
| PubChem CID | 89205829 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine |
| SMILES | [H]/N=C/c1scc2c1OCCO2 |
| InChI | InChI=1S/C7H7NO2S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h3-4,8H,1-2H2/b8-3+ |
| InChIKey | QVTKWEGMZKQOTD-FPYGCLRLSA-N |
| XLogP | 1.52 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine (CID 89205829) is 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine is [H]/N=C/c1scc2c1OCCO2.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine?
The InChIKey is QVTKWEGMZKQOTD-FPYGCLRLSA-N. The full InChI is InChI=1S/C7H7NO2S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h3-4,8H,1-2H2/b8-3+.
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine?
2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine has a molecular weight of 169.21 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethanimine is sourced from PubChem (CID 89205829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).