C22H17FN4O4S2 — CID 89205863
(5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione (PubChem CID 89205863) has the molecular formula C22H17FN4O4S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89205863 |
| Molecular Formula | C22H17FN4O4S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3nc(-c4ccc(F)cc4)cs3)NC(=O)N(S)C1=O)C2 |
| InChI | InChI=1S/C22H17FN4O4S2/c1-31-15-7-4-13-9-26(18(28)16(13)8-15)11-22(20(29)27(32)21(30)25-22)19-24-17(10-33-19)12-2-5-14(23)6-3-12/h2-8,10,32H,9,11H2,1H3,(H,25,30)/t22-/m0/s1 |
| InChIKey | ZWOVUPLEBJBPOG-QFIPXVFZSA-N |
| XLogP | 3.21 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|