C16H13BrN4O4S2 — CID 89205865
(5R)-5-(4-bromo-1,3-thiazol-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione (PubChem CID 89205865) has the molecular formula C16H13BrN4O4S2 and a molecular weight of 469.34 g/mol. Its IUPAC name is (5R)-5-(4-bromo-1,3-thiazol-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-bromo-1,3-thiazol-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89205865 |
| Molecular Formula | C16H13BrN4O4S2 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | (5R)-5-(4-bromo-1,3-thiazol-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-sulfanylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3nc(Br)cs3)NC(=O)N(S)C1=O)C2 |
| InChI | InChI=1S/C16H13BrN4O4S2/c1-25-9-3-2-8-5-20(12(22)10(8)4-9)7-16(13-18-11(17)6-27-13)14(23)21(26)15(24)19-16/h2-4,6,26H,5,7H2,1H3,(H,19,24)/t16-/m0/s1 |
| InChIKey | MMKGUUKCBZEBKC-INIZCTEOSA-N |
| XLogP | 2.16 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|