About (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene
(1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene (PubChem CID 89205877) has the molecular formula C10H11F
and a molecular weight of 150.20 g/mol. Its IUPAC name is (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 89205877 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene |
| SMILES | C[C@H]1CCc2cccc(F)c21 |
| InChI | InChI=1S/C10H11F/c1-7-5-6-8-3-2-4-9(11)10(7)8/h2-4,7H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | DNIGJKYKLSUFCF-ZETCQYMHSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene?
The IUPAC name of (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene (CID 89205877) is (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene is C[C@H]1CCc2cccc(F)c21.
What is the InChIKey of (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene?
The InChIKey is DNIGJKYKLSUFCF-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H11F/c1-7-5-6-8-3-2-4-9(11)10(7)8/h2-4,7H,5-6H2,1H3/t7-/m0/s1.
What are the key properties of (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene?
(1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene has a molecular weight of 150.20 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-7-fluoro-1-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 89205877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).