About methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate
methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate (PubChem CID 89206042) has the molecular formula C11H24O3Si
and a molecular weight of 232.40 g/mol. Its IUPAC name is methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate.
Molecular Properties
| Compound Name | methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate |
| PubChem CID | 89206042 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate |
| SMILES | COC(=O)CC(C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C11H24O3Si/c1-9(7-10(12)14-4)8-11(2,3)15(5,6)13/h9,13H,7-8H2,1-6H3 |
| InChIKey | ISQHOPUPMSDLFL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate?
The IUPAC name of methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate (CID 89206042) is methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate.
What is the SMILES notation for methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate?
The canonical SMILES for methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate is COC(=O)CC(C)CC(C)(C)[Si](C)(C)O.
What is the InChIKey of methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate?
The InChIKey is ISQHOPUPMSDLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O3Si/c1-9(7-10(12)14-4)8-11(2,3)15(5,6)13/h9,13H,7-8H2,1-6H3.
What are the key properties of methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate?
methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate has a molecular weight of 232.40 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[hydroxy(dimethyl)silyl]-3,5-dimethylhexanoate is sourced from PubChem (CID 89206042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).