C12H16N2O — CID 89206609
(1Z,3E)-1-methoxy-2-phenylpenta-1,3-diene-1,4-diamine (PubChem CID 89206609) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (1Z,3E)-1-methoxy-2-phenylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-1-methoxy-2-phenylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 89206609 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (1Z,3E)-1-methoxy-2-phenylpenta-1,3-diene-1,4-diamine |
| SMILES | CO/C(N)=C(/C=C(\C)N)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-9(13)8-11(12(14)15-2)10-6-4-3-5-7-10/h3-8H,13-14H2,1-2H3/b9-8+,12-11- |
| InChIKey | VPMIBLFAMREPMH-UPDVNHGHSA-N |
| XLogP | 1.82 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|