C27H34FN5O4S — CID 89206677
2-(4-aminophenyl)-N-[1-[(2R)-1-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-3-fluoroanilino]propan-2-yl]piperidin-4-yl]acetamide (PubChem CID 89206677) has the molecular formula C27H34FN5O4S and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-[(2R)-1-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-3-fluoroanilino]propan-2-yl]piperidin-4-yl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[1-[(2R)-1-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-3-fluoroanilino]propan-2-yl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 89206677 |
| Molecular Formula | C27H34FN5O4S |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-[(2R)-1-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-3-fluoroanilino]propan-2-yl]piperidin-4-yl]acetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C[C@@H](C)N1CCC(NC(=O)Cc2ccc(N)cc2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H34FN5O4S/c1-18(32-13-11-24(12-14-32)30-26(34)15-21-7-9-23(29)10-8-21)17-33(25-6-4-5-22(28)16-25)38(35,36)27-19(2)31-37-20(27)3/h4-10,16,18,24H,11-15,17,29H2,1-3H3,(H,30,34)/t18-/m1/s1 |
| InChIKey | SXRRAIPGLNEMOJ-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|