About 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile
2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile (PubChem CID 89207039) has the molecular formula C18H13NO2
and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile.
Molecular Properties
| Compound Name | 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile |
| PubChem CID | 89207039 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile |
| SMILES | N#CC(C(=O)C1CO1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13NO2/c19-11-15(18(20)16-12-21-16)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,12H2 |
| InChIKey | GBTZTMWNAMDFBP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile?
The IUPAC name of 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile (CID 89207039) is 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile.
What is the SMILES notation for 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile?
The canonical SMILES for 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile is N#CC(C(=O)C1CO1)=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile?
The InChIKey is GBTZTMWNAMDFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO2/c19-11-15(18(20)16-12-21-16)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,12H2.
What are the key properties of 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile?
2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile has a molecular weight of 275.31 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxirane-2-carbonyl)-3,3-diphenylprop-2-enenitrile is sourced from PubChem (CID 89207039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).