C16H10F5NO2 — CID 89207078
6-hydroxy-7-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methyl]-3H-isoindol-1-one (PubChem CID 89207078) has the molecular formula C16H10F5NO2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 6-hydroxy-7-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 6-hydroxy-7-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 89207078 |
| Molecular Formula | C16H10F5NO2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 6-hydroxy-7-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methyl]-3H-isoindol-1-one |
| SMILES | Cc1c(O)ccc2c1C(=O)N(Cc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C16H10F5NO2/c1-6-9(23)3-2-7-4-22(16(24)10(6)7)5-8-11(17)13(19)15(21)14(20)12(8)18/h2-3,23H,4-5H2,1H3 |
| InChIKey | WTHKSJPWLJCOLQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|