C15H22ClNO3 — CID 89207122
6-(2-chloroethyl)-7-(cyclohex-2-en-1-ylmethyl)-7-methyl-1,4-oxazepane-2,5-dione (PubChem CID 89207122) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 6-(2-chloroethyl)-7-(cyclohex-2-en-1-ylmethyl)-7-methyl-1,4-oxazepane-2,5-dione.
| Compound Name | 6-(2-chloroethyl)-7-(cyclohex-2-en-1-ylmethyl)-7-methyl-1,4-oxazepane-2,5-dione |
|---|---|
| PubChem CID | 89207122 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(2-chloroethyl)-7-(cyclohex-2-en-1-ylmethyl)-7-methyl-1,4-oxazepane-2,5-dione |
| SMILES | CC1(CC2C=CCCC2)OC(=O)CNC(=O)C1CCCl |
| InChI | InChI=1S/C15H22ClNO3/c1-15(9-11-5-3-2-4-6-11)12(7-8-16)14(19)17-10-13(18)20-15/h3,5,11-12H,2,4,6-10H2,1H3,(H,17,19) |
| InChIKey | LRMRXQYNGWHYRB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|