C10H15FO — CID 89207204
(2E,3E,5E)-2-ethylidene-4-fluoroocta-3,5-dien-1-ol (PubChem CID 89207204) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is (2E,3E,5E)-2-ethylidene-4-fluoroocta-3,5-dien-1-ol.
| Compound Name | (2E,3E,5E)-2-ethylidene-4-fluoroocta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 89207204 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2E,3E,5E)-2-ethylidene-4-fluoroocta-3,5-dien-1-ol |
| SMILES | C/C=C(\C=C(F)/C=C/CC)CO |
| InChI | InChI=1S/C10H15FO/c1-3-5-6-10(11)7-9(4-2)8-12/h4-7,12H,3,8H2,1-2H3/b6-5+,9-4+,10-7+ |
| InChIKey | LGHULCQEKHIELO-SIZPBZAJSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|