C17H27N5O3 — CID 89207246
4-amino-N-[(E)-1-[methyl-[3-oxo-3-(4-oxopentylamino)prop-1-en-2-yl]amino]prop-1-en-2-yl]-2,3-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 89207246) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-amino-N-[(E)-1-[methyl-[3-oxo-3-(4-oxopentylamino)prop-1-en-2-yl]amino]prop-1-en-2-yl]-2,3-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[(E)-1-[methyl-[3-oxo-3-(4-oxopentylamino)prop-1-en-2-yl]amino]prop-1-en-2-yl]-2,3-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 89207246 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 4-amino-N-[(E)-1-[methyl-[3-oxo-3-(4-oxopentylamino)prop-1-en-2-yl]amino]prop-1-en-2-yl]-2,3-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | C=C(C(=O)NCCCC(C)=O)N(C)/C=C(\C)NC(=O)C1CC(N)=CN1 |
| InChI | InChI=1S/C17H27N5O3/c1-11(21-17(25)15-8-14(18)9-20-15)10-22(4)13(3)16(24)19-7-5-6-12(2)23/h9-10,15,20H,3,5-8,18H2,1-2,4H3,(H,19,24)(H,21,25)/b11-10+ |
| InChIKey | CRWOJGDLISWGTB-ZHACJKMWSA-N |
| XLogP | 0.06 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|