C19H17F3N2O2 — CID 89207265
(2,3,4-trifluorophenyl) 4-[(6-methyl-2-pyridinyl)methylidene]piperidine-1-carboxylate (PubChem CID 89207265) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl) 4-[(6-methyl-2-pyridinyl)methylidene]piperidine-1-carboxylate.
| Compound Name | (2,3,4-trifluorophenyl) 4-[(6-methyl-2-pyridinyl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89207265 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (2,3,4-trifluorophenyl) 4-[(6-methyl-2-pyridinyl)methylidene]piperidine-1-carboxylate |
| SMILES | Cc1cccc(C=C2CCN(C(=O)Oc3ccc(F)c(F)c3F)CC2)n1 |
| InChI | InChI=1S/C19H17F3N2O2/c1-12-3-2-4-14(23-12)11-13-7-9-24(10-8-13)19(25)26-16-6-5-15(20)17(21)18(16)22/h2-6,11H,7-10H2,1H3 |
| InChIKey | LHSXEGJNECDJPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|