About 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine
6-methoxy-4-N-methylpyrimidine-2,4,5-triamine (PubChem CID 89207307) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine.
Molecular Properties
| Compound Name | 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine |
| PubChem CID | 89207307 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine |
| SMILES | CNc1nc(N)nc(OC)c1N |
| InChI | InChI=1S/C6H11N5O/c1-9-4-3(7)5(12-2)11-6(8)10-4/h7H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | AFAQEDIVAWGQOG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine?
The IUPAC name of 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine (CID 89207307) is 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine.
What is the SMILES notation for 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine?
The canonical SMILES for 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine is CNc1nc(N)nc(OC)c1N.
What is the InChIKey of 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine?
The InChIKey is AFAQEDIVAWGQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O/c1-9-4-3(7)5(12-2)11-6(8)10-4/h7H2,1-2H3,(H3,8,9,10,11).
What are the key properties of 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine?
6-methoxy-4-N-methylpyrimidine-2,4,5-triamine has a molecular weight of 169.19 g/mol, XLogP of -0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-N-methylpyrimidine-2,4,5-triamine is sourced from PubChem (CID 89207307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).