C38H22F8O6S2 — CID 89207382
1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]benzene (PubChem CID 89207382) has the molecular formula C38H22F8O6S2 and a molecular weight of 790.71 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]benzene |
|---|---|
| PubChem CID | 89207382 |
| Molecular Formula | C38H22F8O6S2 |
| Molecular Weight | 790.71 g/mol |
| Exact Mass | 790.07 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]benzene |
| SMILES | COc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccc(S(=O)(=O)c4ccc(-c5ccc(S(=O)(=O)c6ccc(C)cc6)cc5)cc4)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C38H22F8O6S2/c1-19-3-11-23(12-4-19)53(47,48)24-13-5-20(6-14-24)21-7-15-25(16-8-21)54(49,50)26-17-9-22(10-18-26)52-38-35(45)31(41)28(32(42)36(38)46)27-29(39)33(43)37(51-2)34(44)30(27)40/h3-18H,1-2H3 |
| InChIKey | RTSAQVRCDKBOEO-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.71 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|