C15H23N — CID 89207572
(8-but-3-en-2-yl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl)methanimine (PubChem CID 89207572) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (8-but-3-en-2-yl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl)methanimine.
| Compound Name | (8-but-3-en-2-yl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl)methanimine |
|---|---|
| PubChem CID | 89207572 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (8-but-3-en-2-yl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl)methanimine |
| SMILES | [H]/N=C/C1CCCC2CC=CC(C(C)C=C)C12 |
| InChI | InChI=1S/C15H23N/c1-3-11(2)14-9-5-7-12-6-4-8-13(10-16)15(12)14/h3,5,9-16H,1,4,6-8H2,2H3/b16-10+ |
| InChIKey | URELQWODLQRYKE-MHWRWJLKSA-N |
| XLogP | 4.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|