About (E)-N,3-diethyl-4-fluoropent-3-en-2-imine
(E)-N,3-diethyl-4-fluoropent-3-en-2-imine (PubChem CID 89207606) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is (E)-N,3-diethyl-4-fluoropent-3-en-2-imine.
Molecular Properties
| Compound Name | (E)-N,3-diethyl-4-fluoropent-3-en-2-imine |
| PubChem CID | 89207606 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (E)-N,3-diethyl-4-fluoropent-3-en-2-imine |
| SMILES | CC/N=C(C)/C(CC)=C(\C)F |
| InChI | InChI=1S/C9H16FN/c1-5-9(7(3)10)8(4)11-6-2/h5-6H2,1-4H3/b9-7+,11-8+ |
| InChIKey | ASKPMEXIQDOHAZ-BIZFVBGRSA-N |
| XLogP | 3.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,3-diethyl-4-fluoropent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,3-diethyl-4-fluoropent-3-en-2-imine?
The IUPAC name of (E)-N,3-diethyl-4-fluoropent-3-en-2-imine (CID 89207606) is (E)-N,3-diethyl-4-fluoropent-3-en-2-imine.
What is the SMILES notation for (E)-N,3-diethyl-4-fluoropent-3-en-2-imine?
The canonical SMILES for (E)-N,3-diethyl-4-fluoropent-3-en-2-imine is CC/N=C(C)/C(CC)=C(\C)F.
What is the InChIKey of (E)-N,3-diethyl-4-fluoropent-3-en-2-imine?
The InChIKey is ASKPMEXIQDOHAZ-BIZFVBGRSA-N. The full InChI is InChI=1S/C9H16FN/c1-5-9(7(3)10)8(4)11-6-2/h5-6H2,1-4H3/b9-7+,11-8+.
What are the key properties of (E)-N,3-diethyl-4-fluoropent-3-en-2-imine?
(E)-N,3-diethyl-4-fluoropent-3-en-2-imine has a molecular weight of 157.23 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,3-diethyl-4-fluoropent-3-en-2-imine is sourced from PubChem (CID 89207606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).