C19H31BrO5 — CID 89207607
ethyl 4-[(2E,4E)-5-(bromomethyl)-4-(3-ethoxy-3-hydroxypropyl)hepta-2,4,6-trien-3-yl]oxybutanoate (PubChem CID 89207607) has the molecular formula C19H31BrO5 and a molecular weight of 419.36 g/mol. Its IUPAC name is ethyl 4-[(2E,4E)-5-(bromomethyl)-4-(3-ethoxy-3-hydroxypropyl)hepta-2,4,6-trien-3-yl]oxybutanoate.
| Compound Name | ethyl 4-[(2E,4E)-5-(bromomethyl)-4-(3-ethoxy-3-hydroxypropyl)hepta-2,4,6-trien-3-yl]oxybutanoate |
|---|---|
| PubChem CID | 89207607 |
| Molecular Formula | C19H31BrO5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 4-[(2E,4E)-5-(bromomethyl)-4-(3-ethoxy-3-hydroxypropyl)hepta-2,4,6-trien-3-yl]oxybutanoate |
| SMILES | C=C/C(CBr)=C(CCC(O)OCC)\C(=C/C)OCCCC(=O)OCC |
| InChI | InChI=1S/C19H31BrO5/c1-5-15(14-20)16(11-12-19(22)24-8-4)17(6-2)25-13-9-10-18(21)23-7-3/h5-6,19,22H,1,7-14H2,2-4H3/b16-15+,17-6+ |
| InChIKey | GACQPIPQBCFQRS-DRCILVDTSA-N |
| XLogP | 4.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|