C31H18F2O8 — CID 89207961
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,3-difluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione (PubChem CID 89207961) has the molecular formula C31H18F2O8 and a molecular weight of 556.47 g/mol. Its IUPAC name is 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,3-difluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,3-difluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 89207961 |
| Molecular Formula | C31H18F2O8 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,3-difluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(Oc3ccc(C(CF)(CF)c4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)cc3)ccc21 |
| InChI | InChI=1S/C31H18F2O8/c32-15-31(16-33,17-1-5-19(6-2-17)38-21-9-11-23-25(13-21)29(36)40-27(23)34)18-3-7-20(8-4-18)39-22-10-12-24-26(14-22)30(37)41-28(24)35/h1-14H,15-16H2 |
| InChIKey | AJZHQDOSFALENX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|