C25H22F7NO4 — CID 89207982
methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate (PubChem CID 89207982) has the molecular formula C25H22F7NO4 and a molecular weight of 533.44 g/mol. Its IUPAC name is methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate.
| Compound Name | methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 89207982 |
| Molecular Formula | C25H22F7NO4 |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
| SMILES | COC(=O)C1C[C@H]2C(c3ccc(F)cc3)[C@@H](O[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN2C1=O |
| InChI | InChI=1S/C25H22F7NO4/c1-12(14-7-15(24(27,28)29)9-16(8-14)25(30,31)32)37-20-11-33-19(10-18(22(33)34)23(35)36-2)21(20)13-3-5-17(26)6-4-13/h3-9,12,18-21H,10-11H2,1-2H3/t12-,18?,19+,20+,21?/m1/s1 |
| InChIKey | AJAMBWJUCAHXKV-SONTTWJJSA-N |
| XLogP | 5.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|