C12H18N2 — CID 89208105
(2E,4E)-4-(3-methylidenepyrrolidin-1-yl)hepta-2,4,6-trien-3-amine (PubChem CID 89208105) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2E,4E)-4-(3-methylidenepyrrolidin-1-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-(3-methylidenepyrrolidin-1-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89208105 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2E,4E)-4-(3-methylidenepyrrolidin-1-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(C(\N)=C/C)/N1CCC(=C)C1 |
| InChI | InChI=1S/C12H18N2/c1-4-6-12(11(13)5-2)14-8-7-10(3)9-14/h4-6H,1,3,7-9,13H2,2H3/b11-5+,12-6+ |
| InChIKey | ZSPZLKRXKKPPMS-YDWXAUTNSA-N |
| XLogP | 2.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|