C9H14N2O2 — CID 89208394
1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 89208394) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 89208394 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | OCCn1ncc2c1CCCC2O |
| InChI | InChI=1S/C9H14N2O2/c12-5-4-11-8-2-1-3-9(13)7(8)6-10-11/h6,9,12-13H,1-5H2 |
| InChIKey | QUWPROYUNUPRHC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |