About 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane
2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane (PubChem CID 89208750) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane |
| PubChem CID | 89208750 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane |
| SMILES | C/C(=C\C1OCCO1)CCCC(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h9-10,12H,4-8H2,1-3H3/b11-9+ |
| InChIKey | NWNMOZOUUDGXDQ-PKNBQFBNSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane?
The IUPAC name of 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane (CID 89208750) is 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane.
What is the SMILES notation for 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane?
The canonical SMILES for 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane is C/C(=C\C1OCCO1)CCCC(C)C.
What is the InChIKey of 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane?
The InChIKey is NWNMOZOUUDGXDQ-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H22O2/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h9-10,12H,4-8H2,1-3H3/b11-9+.
What are the key properties of 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane?
2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane has a molecular weight of 198.31 g/mol, XLogP of 3.13, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2,6-dimethylhept-1-enyl]-1,3-dioxolane is sourced from PubChem (CID 89208750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).