C12H21N3O7S3 — CID 89208751
6-[2-(dihydroxyamino)oxyethyl]-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 89208751) has the molecular formula C12H21N3O7S3 and a molecular weight of 415.52 g/mol. Its IUPAC name is 6-[2-(dihydroxyamino)oxyethyl]-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 6-[2-(dihydroxyamino)oxyethyl]-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 89208751 |
| Molecular Formula | C12H21N3O7S3 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 6-[2-(dihydroxyamino)oxyethyl]-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCCNC1CC(CCON(O)O)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C12H21N3O7S3/c1-2-4-14-10-6-8(3-5-22-15(16)17)24(18,19)12-9(10)7-11(23-12)25(13,20)21/h7-8,10,14,16-17H,2-6H2,1H3,(H2,13,20,21) |
| InChIKey | WXVFVVKQUMARJV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|