About [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate
[(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate (PubChem CID 89208791) has the molecular formula C11H15ClO3
and a molecular weight of 230.69 g/mol. Its IUPAC name is [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate.
Molecular Properties
| Compound Name | [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate |
| PubChem CID | 89208791 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate |
| SMILES | COCC1C=CC(COC(=O)Cl)=C[C@@H]1C |
| InChI | InChI=1S/C11H15ClO3/c1-8-5-9(6-15-11(12)13)3-4-10(8)7-14-2/h3-5,8,10H,6-7H2,1-2H3/t8-,10?/m0/s1 |
| InChIKey | WZQHPRXCILJRKU-PEHGTWAWSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate?
The IUPAC name of [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate (CID 89208791) is [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate.
What is the SMILES notation for [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate?
The canonical SMILES for [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate is COCC1C=CC(COC(=O)Cl)=C[C@@H]1C.
What is the InChIKey of [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate?
The InChIKey is WZQHPRXCILJRKU-PEHGTWAWSA-N. The full InChI is InChI=1S/C11H15ClO3/c1-8-5-9(6-15-11(12)13)3-4-10(8)7-14-2/h3-5,8,10H,6-7H2,1-2H3/t8-,10?/m0/s1.
What are the key properties of [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate?
[(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate has a molecular weight of 230.69 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4-(methoxymethyl)-3-methylcyclohexa-1,5-dien-1-yl]methyl carbonochloridate is sourced from PubChem (CID 89208791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).