About (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol
(3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol (PubChem CID 89208831) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol |
| PubChem CID | 89208831 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol |
| SMILES | C=C(/C=C(\C=C/N)CC)CO |
| InChI | InChI=1S/C9H15NO/c1-3-9(4-5-10)6-8(2)7-11/h4-6,11H,2-3,7,10H2,1H3/b5-4-,9-6- |
| InChIKey | MTQOKSIVYKELID-WXOLFVLTSA-N |
| XLogP | 1.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol?
The IUPAC name of (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol (CID 89208831) is (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol.
What is the SMILES notation for (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol?
The canonical SMILES for (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol is C=C(/C=C(\C=C/N)CC)CO.
What is the InChIKey of (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol?
The InChIKey is MTQOKSIVYKELID-WXOLFVLTSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-9(4-5-10)6-8(2)7-11/h4-6,11H,2-3,7,10H2,1H3/b5-4-,9-6-.
What are the key properties of (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol?
(3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol has a molecular weight of 153.22 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-6-amino-4-ethyl-2-methylidenehexa-3,5-dien-1-ol is sourced from PubChem (CID 89208831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).