C9H13NO2S2 — CID 89208889
3-[[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]disulfanyl]propanoic acid (PubChem CID 89208889) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]disulfanyl]propanoic acid.
| Compound Name | 3-[[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 89208889 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 3-[[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]disulfanyl]propanoic acid |
| SMILES | C=C(/C=C\C=C/N)SSCCC(=O)O |
| InChI | InChI=1S/C9H13NO2S2/c1-8(4-2-3-6-10)14-13-7-5-9(11)12/h2-4,6H,1,5,7,10H2,(H,11,12)/b4-2-,6-3- |
| InChIKey | YLZJRBUAWWJRTK-ZUMAWFIWSA-N |
| XLogP | 2.38 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|