C19H15ClFN3S — CID 89208921
N-[(6-chloro-2-fluorocyclohexa-1,3-dien-1-yl)methyl]-6-phenylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 89208921) has the molecular formula C19H15ClFN3S and a molecular weight of 371.87 g/mol. Its IUPAC name is N-[(6-chloro-2-fluorocyclohexa-1,3-dien-1-yl)methyl]-6-phenylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(6-chloro-2-fluorocyclohexa-1,3-dien-1-yl)methyl]-6-phenylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89208921 |
| Molecular Formula | C19H15ClFN3S |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[(6-chloro-2-fluorocyclohexa-1,3-dien-1-yl)methyl]-6-phenylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | FC1=C(CNc2ncnc3cc(-c4ccccc4)sc23)C(Cl)CC=C1 |
| InChI | InChI=1S/C19H15ClFN3S/c20-14-7-4-8-15(21)13(14)10-22-19-18-16(23-11-24-19)9-17(25-18)12-5-2-1-3-6-12/h1-6,8-9,11,14H,7,10H2,(H,22,23,24) |
| InChIKey | WMCBXPOOUGCMTC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|