C9H14BrNO2 — CID 89209093
(1E,3E)-2-bromo-4-(2-methoxyethoxy)hexa-1,3,5-trien-1-amine (PubChem CID 89209093) has the molecular formula C9H14BrNO2 and a molecular weight of 248.12 g/mol. Its IUPAC name is (1E,3E)-2-bromo-4-(2-methoxyethoxy)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-2-bromo-4-(2-methoxyethoxy)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89209093 |
| Molecular Formula | C9H14BrNO2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (1E,3E)-2-bromo-4-(2-methoxyethoxy)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C(Br)=C/N)OCCOC |
| InChI | InChI=1S/C9H14BrNO2/c1-3-9(6-8(10)7-11)13-5-4-12-2/h3,6-7H,1,4-5,11H2,2H3/b8-7+,9-6+ |
| InChIKey | WXQUIXNNCJLXFP-KHHFIZIMSA-N |
| XLogP | 1.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|