C30H39IO4S — CID 89209188
[(8S,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-8-iodo-7,11,13-trimethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-ethylphenyl)sulfanylacetate (PubChem CID 89209188) has the molecular formula C30H39IO4S and a molecular weight of 622.61 g/mol. Its IUPAC name is [(8S,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-8-iodo-7,11,13-trimethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-ethylphenyl)sulfanylacetate.
| Compound Name | [(8S,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-8-iodo-7,11,13-trimethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-ethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 89209188 |
| Molecular Formula | C30H39IO4S |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | [(8S,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-8-iodo-7,11,13-trimethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(2-ethylphenyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2ccccc2CC)[C@]2(I)C(C)CC34CC(CCC3=O)(C42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H39IO4S/c1-6-20-10-8-9-11-21(20)36-16-24(33)35-23-15-27(5,7-2)25(34)19(4)28-13-12-22(32)29(17-28)14-18(3)30(23,31)26(28)29/h7-11,18-19,23,25-26,34H,2,6,12-17H2,1,3-5H3/t18?,19-,23+,25-,26?,27+,28?,29?,30+/m0/s1 |
| InChIKey | KDWPOPLEOSKHRS-XNSSSOKXSA-N |
| XLogP | 6.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|