About 2-methanimidoylcyclohexane-1,4-diol
2-methanimidoylcyclohexane-1,4-diol (PubChem CID 89209202) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-methanimidoylcyclohexane-1,4-diol.
Molecular Properties
| Compound Name | 2-methanimidoylcyclohexane-1,4-diol |
| PubChem CID | 89209202 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-methanimidoylcyclohexane-1,4-diol |
| SMILES | [H]/N=C/C1CC(O)CCC1O |
| InChI | InChI=1S/C7H13NO2/c8-4-5-3-6(9)1-2-7(5)10/h4-10H,1-3H2/b8-4+ |
| InChIKey | PXRCEFGXSUVMHL-XBXARRHUSA-N |
| XLogP | 0.16 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoylcyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoylcyclohexane-1,4-diol?
The IUPAC name of 2-methanimidoylcyclohexane-1,4-diol (CID 89209202) is 2-methanimidoylcyclohexane-1,4-diol.
What is the SMILES notation for 2-methanimidoylcyclohexane-1,4-diol?
The canonical SMILES for 2-methanimidoylcyclohexane-1,4-diol is [H]/N=C/C1CC(O)CCC1O.
What is the InChIKey of 2-methanimidoylcyclohexane-1,4-diol?
The InChIKey is PXRCEFGXSUVMHL-XBXARRHUSA-N. The full InChI is InChI=1S/C7H13NO2/c8-4-5-3-6(9)1-2-7(5)10/h4-10H,1-3H2/b8-4+.
What are the key properties of 2-methanimidoylcyclohexane-1,4-diol?
2-methanimidoylcyclohexane-1,4-diol has a molecular weight of 143.19 g/mol, XLogP of 0.16, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoylcyclohexane-1,4-diol is sourced from PubChem (CID 89209202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).