C23H32N4 — CID 89209266
2-[4-(5-amino-1,3,3-trimethylindol-2-ylidene)-2-methylbutan-2-yl]-1-N-methylbenzene-1,4-diamine (PubChem CID 89209266) has the molecular formula C23H32N4 and a molecular weight of 364.54 g/mol. Its IUPAC name is 2-[4-(5-amino-1,3,3-trimethylindol-2-ylidene)-2-methylbutan-2-yl]-1-N-methylbenzene-1,4-diamine.
| Compound Name | 2-[4-(5-amino-1,3,3-trimethylindol-2-ylidene)-2-methylbutan-2-yl]-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 89209266 |
| Molecular Formula | C23H32N4 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-[4-(5-amino-1,3,3-trimethylindol-2-ylidene)-2-methylbutan-2-yl]-1-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N)cc1C(C)(C)CC=C1N(C)c2ccc(N)cc2C1(C)C |
| InChI | InChI=1S/C23H32N4/c1-22(2,17-13-15(24)7-9-19(17)26-5)12-11-21-23(3,4)18-14-16(25)8-10-20(18)27(21)6/h7-11,13-14,26H,12,24-25H2,1-6H3 |
| InChIKey | NXKACNKFSDFVAK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|