C13H26N2S — CID 89209288
N'-[(3E,5E)-6-methylsulfanylhepta-3,5-dien-3-yl]pentane-1,5-diamine (PubChem CID 89209288) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is N'-[(3E,5E)-6-methylsulfanylhepta-3,5-dien-3-yl]pentane-1,5-diamine.
| Compound Name | N'-[(3E,5E)-6-methylsulfanylhepta-3,5-dien-3-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 89209288 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N'-[(3E,5E)-6-methylsulfanylhepta-3,5-dien-3-yl]pentane-1,5-diamine |
| SMILES | CC/C(=C\C=C(/C)SC)NCCCCCN |
| InChI | InChI=1S/C13H26N2S/c1-4-13(9-8-12(2)16-3)15-11-7-5-6-10-14/h8-9,15H,4-7,10-11,14H2,1-3H3/b12-8+,13-9+ |
| InChIKey | MXUNXWKRQCTQRQ-QHKWOANTSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|