C16H33N3 — CID 89209331
N'-[2-[ethyl-[(2E,4Z)-hepta-2,4-dien-2-yl]amino]ethyl]pentane-1,5-diamine (PubChem CID 89209331) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is N'-[2-[ethyl-[(2E,4Z)-hepta-2,4-dien-2-yl]amino]ethyl]pentane-1,5-diamine.
| Compound Name | N'-[2-[ethyl-[(2E,4Z)-hepta-2,4-dien-2-yl]amino]ethyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 89209331 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | N'-[2-[ethyl-[(2E,4Z)-hepta-2,4-dien-2-yl]amino]ethyl]pentane-1,5-diamine |
| SMILES | CC/C=C\C=C(/C)N(CC)CCNCCCCCN |
| InChI | InChI=1S/C16H33N3/c1-4-6-8-11-16(3)19(5-2)15-14-18-13-10-7-9-12-17/h6,8,11,18H,4-5,7,9-10,12-15,17H2,1-3H3/b8-6-,16-11+ |
| InChIKey | XVNNPDBZPKCIJA-GEVRQCGLSA-N |
| XLogP | 2.90 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|