C16H30N2O2 — CID 89209333
N'-[(3Z,4E)-3-ethylidene-5,6-dimethoxyhepta-4,6-dienyl]pentane-1,5-diamine (PubChem CID 89209333) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N'-[(3Z,4E)-3-ethylidene-5,6-dimethoxyhepta-4,6-dienyl]pentane-1,5-diamine.
| Compound Name | N'-[(3Z,4E)-3-ethylidene-5,6-dimethoxyhepta-4,6-dienyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 89209333 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N'-[(3Z,4E)-3-ethylidene-5,6-dimethoxyhepta-4,6-dienyl]pentane-1,5-diamine |
| SMILES | C=C(OC)/C(=C\C(=C/C)CCNCCCCCN)OC |
| InChI | InChI=1S/C16H30N2O2/c1-5-15(13-16(20-4)14(2)19-3)9-12-18-11-8-6-7-10-17/h5,13,18H,2,6-12,17H2,1,3-4H3/b15-5-,16-13+ |
| InChIKey | UGDNKCJWTUAXCM-BXXQQOARSA-N |
| XLogP | 2.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|