About N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine
N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine (PubChem CID 89209356) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine |
| PubChem CID | 89209356 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine |
| SMILES | C#CCC/C=C(\CCC)NCCCCCNC |
| InChI | InChI=1S/C15H28N2/c1-4-6-8-12-15(11-5-2)17-14-10-7-9-13-16-3/h1,12,16-17H,5-11,13-14H2,2-3H3/b15-12+ |
| InChIKey | ARJAMQAYRCRXPF-NTCAYCPXSA-N |
| XLogP | 3.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine?
The IUPAC name of N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine (CID 89209356) is N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine.
What is the SMILES notation for N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine?
The canonical SMILES for N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine is C#CCC/C=C(\CCC)NCCCCCNC.
What is the InChIKey of N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine?
The InChIKey is ARJAMQAYRCRXPF-NTCAYCPXSA-N. The full InChI is InChI=1S/C15H28N2/c1-4-6-8-12-15(11-5-2)17-14-10-7-9-13-16-3/h1,12,16-17H,5-11,13-14H2,2-3H3/b15-12+.
What are the key properties of N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine?
N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine has a molecular weight of 236.40 g/mol, XLogP of 3.06, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[(E)-non-4-en-8-yn-4-yl]pentane-1,5-diamine is sourced from PubChem (CID 89209356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).